C27H21BrClN3O7 — CID 126233294
2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126233294) has the molecular formula C27H21BrClN3O7 and a molecular weight of 614.84 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126233294 |
| Molecular Formula | C27H21BrClN3O7 |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(O)cc3)C2=O)cc(Br)c1OCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H21BrClN3O7/c1-2-38-22-13-15(12-21(28)24(22)39-14-23(34)30-17-5-3-16(29)4-6-17)11-20-25(35)31-27(37)32(26(20)36)18-7-9-19(33)10-8-18/h3-13,33H,2,14H2,1H3,(H,30,34)(H,31,35,37)/b20-11+ |
| InChIKey | XMURRBXSHSCHPF-RGVLZGJSSA-N |
| XLogP | 4.89 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|