C21H17BrN4O8 — CID 126223778
2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126223778) has the molecular formula C21H17BrN4O8 and a molecular weight of 533.29 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126223778 |
| Molecular Formula | C21H17BrN4O8 |
| Molecular Weight | 533.29 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc(Br)c1OCC(N)=O |
| InChI | InChI=1S/C21H17BrN4O8/c1-2-33-16-9-11(8-15(22)18(16)34-10-17(23)27)7-14-19(28)24-21(30)25(20(14)29)12-3-5-13(6-4-12)26(31)32/h3-9H,2,10H2,1H3,(H2,23,27)(H,24,28,30)/b14-7+ |
| InChIKey | DKWDXCQMJAUBBM-VGOFMYFVSA-N |
| XLogP | 2.29 |
| TPSA | 171.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|