C20H15Br2N3O6 — CID 126225034
2-[2,6-dibromo-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126225034) has the molecular formula C20H15Br2N3O6 and a molecular weight of 553.16 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126225034 |
| Molecular Formula | C20H15Br2N3O6 |
| Molecular Weight | 553.16 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Br)c(OCC(N)=O)c(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H15Br2N3O6/c1-30-12-4-2-11(3-5-12)25-19(28)13(18(27)24-20(25)29)6-10-7-14(21)17(15(22)8-10)31-9-16(23)26/h2-8H,9H2,1H3,(H2,23,26)(H,24,27,29)/b13-6+ |
| InChIKey | HNLPMQHWFDFVCN-AWNIVKPZSA-N |
| XLogP | 2.75 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|