C21H19N3O7 — CID 2170040
2-[2-methoxy-5-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 2170040) has the molecular formula C21H19N3O7 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-[2-methoxy-5-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-5-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 2170040 |
| Molecular Formula | C21H19N3O7 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[2-methoxy-5-[(E)-[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | COc1ccc(N2C(=O)NC(=O)/C(=C\c3ccc(OC)c(OCC(N)=O)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O7/c1-29-14-6-4-13(5-7-14)24-20(27)15(19(26)23-21(24)28)9-12-3-8-16(30-2)17(10-12)31-11-18(22)25/h3-10H,11H2,1-2H3,(H2,22,25)(H,23,26,28)/b15-9+ |
| InChIKey | WXYPQRRPYOAXLH-OQLLNIDSSA-N |
| XLogP | 1.23 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|