C27H23N3O8 — CID 126386947
2-[4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methoxyphenyl)acetamide (PubChem CID 126386947) has the molecular formula C27H23N3O8 and a molecular weight of 517.49 g/mol. Its IUPAC name is 2-[4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126386947 |
| Molecular Formula | C27H23N3O8 |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 2-[4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=C3/C(=O)NC(=O)N(c4ccc(O)cc4)C3=O)cc2OC)cc1 |
| InChI | InChI=1S/C27H23N3O8/c1-36-20-10-4-17(5-11-20)28-24(32)15-38-22-12-3-16(14-23(22)37-2)13-21-25(33)29-27(35)30(26(21)34)18-6-8-19(31)9-7-18/h3-14,31H,15H2,1-2H3,(H,28,32)(H,29,33,35)/b21-13- |
| InChIKey | KUCUOEZBCRXOIT-BKUYFWCQSA-N |
| XLogP | 3.09 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|