C21H18N2O8 — CID 1010661
2-[2-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 1010661) has the molecular formula C21H18N2O8 and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 1010661 |
| Molecular Formula | C21H18N2O8 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-[2-methoxy-4-[[1-(4-methoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1ccc(N2C(=O)NC(=O)C(=Cc3ccc(OCC(=O)O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H18N2O8/c1-29-14-6-4-13(5-7-14)23-20(27)15(19(26)22-21(23)28)9-12-3-8-16(17(10-12)30-2)31-11-18(24)25/h3-10H,11H2,1-2H3,(H,24,25)(H,22,26,28) |
| InChIKey | XMKGQBUAFKGDGV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|