C27H23BrN2O7 — CID 98204107
(5Z)-1-(4-bromophenyl)-5-[[3-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 98204107) has the molecular formula C27H23BrN2O7 and a molecular weight of 567.39 g/mol. Its IUPAC name is (5Z)-1-(4-bromophenyl)-5-[[3-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(4-bromophenyl)-5-[[3-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 98204107 |
| Molecular Formula | C27H23BrN2O7 |
| Molecular Weight | 567.39 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | (5Z)-1-(4-bromophenyl)-5-[[3-methoxy-4-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(OCCOc2ccc(/C=C3/C(=O)NC(=O)N(c4ccc(Br)cc4)C3=O)cc2OC)cc1 |
| InChI | InChI=1S/C27H23BrN2O7/c1-34-20-8-10-21(11-9-20)36-13-14-37-23-12-3-17(16-24(23)35-2)15-22-25(31)29-27(33)30(26(22)32)19-6-4-18(28)5-7-19/h3-12,15-16H,13-14H2,1-2H3,(H,29,31,33)/b22-15- |
| InChIKey | RCLSYUNMAXDMDQ-JCMHNJIXSA-N |
| XLogP | 4.59 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|