C32H31BrN2O6 — CID 3541529
1-(4-bromophenyl)-5-[[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3541529) has the molecular formula C32H31BrN2O6 and a molecular weight of 619.51 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-[[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-bromophenyl)-5-[[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3541529 |
| Molecular Formula | C32H31BrN2O6 |
| Molecular Weight | 619.51 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | 1-(4-bromophenyl)-5-[[4-[2-(4-cyclohexylphenoxy)ethoxy]-3-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(c3ccc(Br)cc3)C2=O)ccc1OCCOc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H31BrN2O6/c1-39-29-20-21(19-27-30(36)34-32(38)35(31(27)37)25-12-10-24(33)11-13-25)7-16-28(29)41-18-17-40-26-14-8-23(9-15-26)22-5-3-2-4-6-22/h7-16,19-20,22H,2-6,17-18H2,1H3,(H,34,36,38) |
| InChIKey | WDQHLGLAYPZSQL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.51 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|