C23H20N2O9 — CID 126054762
2-[2-ethoxy-4-[(Z)-[1-(4-methoxycarbonylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126054762) has the molecular formula C23H20N2O9 and a molecular weight of 468.42 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-[1-(4-methoxycarbonylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(Z)-[1-(4-methoxycarbonylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126054762 |
| Molecular Formula | C23H20N2O9 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-[1-(4-methoxycarbonylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(C(=O)OC)cc3)C2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C23H20N2O9/c1-3-33-18-11-13(4-9-17(18)34-12-19(26)27)10-16-20(28)24-23(31)25(21(16)29)15-7-5-14(6-8-15)22(30)32-2/h4-11H,3,12H2,1-2H3,(H,26,27)(H,24,28,31)/b16-10- |
| InChIKey | SQGNXGMCNHMVNM-YBEGLDIGSA-N |
| XLogP | 2.00 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|