C27H22N2O7 — CID 126050475
2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid (PubChem CID 126050475) has the molecular formula C27H22N2O7 and a molecular weight of 486.48 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126050475 |
| Molecular Formula | C27H22N2O7 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H22N2O7/c1-2-35-23-16-18(13-14-22(23)36-17-24(30)31)15-21-25(32)28(19-9-5-3-6-10-19)27(34)29(26(21)33)20-11-7-4-8-12-20/h3-16H,2,17H2,1H3,(H,30,31) |
| InChIKey | AQEZBRCOAUFJDV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|