C36H28N2O4S — CID 3658831
5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 3658831) has the molecular formula C36H28N2O4S and a molecular weight of 584.70 g/mol. Its IUPAC name is 5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 3658831 |
| Molecular Formula | C36H28N2O4S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 5-[[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-1,3-diphenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)C(=S)N(c3ccccc3)C2=O)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H28N2O4S/c1-2-41-33-23-25(18-20-32(33)42-24-26-17-19-27-11-9-10-12-28(27)21-26)22-31-34(39)37(29-13-5-3-6-14-29)36(43)38(35(31)40)30-15-7-4-8-16-30/h3-23H,2,24H2,1H3 |
| InChIKey | VWRVWOIZLNMZNT-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|