C34H29N3O6 — CID 126011203
2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126011203) has the molecular formula C34H29N3O6 and a molecular weight of 575.62 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126011203 |
| Molecular Formula | C34H29N3O6 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C34H29N3O6/c1-3-42-30-21-24(16-19-29(30)43-22-31(38)35-25-17-14-23(2)15-18-25)20-28-32(39)36(26-10-6-4-7-11-26)34(41)37(33(28)40)27-12-8-5-9-13-27/h4-21H,3,22H2,1-2H3,(H,35,38) |
| InChIKey | AQMGQRLZKJSKRI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|