C33H26BrN3O6 — CID 126223740
2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126223740) has the molecular formula C33H26BrN3O6 and a molecular weight of 640.49 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126223740 |
| Molecular Formula | C33H26BrN3O6 |
| Molecular Weight | 640.49 g/mol |
| Exact Mass | 639.10 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(C=C2C(=O)N(c3ccccc3)C(=O)N(c3ccccc3)C2=O)cc(Br)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C33H26BrN3O6/c1-21-13-15-23(16-14-21)35-29(38)20-43-30-27(34)18-22(19-28(30)42-2)17-26-31(39)36(24-9-5-3-6-10-24)33(41)37(32(26)40)25-11-7-4-8-12-25/h3-19H,20H2,1-2H3,(H,35,38) |
| InChIKey | DBCNJKHXEQKFTI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|