C27H22BrN3O5S — CID 126271180
2-[2-bromo-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126271180) has the molecular formula C27H22BrN3O5S and a molecular weight of 580.46 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126271180 |
| Molecular Formula | C27H22BrN3O5S |
| Molecular Weight | 580.46 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]-6-methoxyphenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/C(=O)NC(=S)N(c3ccccc3)C2=O)cc(Br)c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C27H22BrN3O5S/c1-16-8-6-7-11-21(16)29-23(32)15-36-24-20(28)13-17(14-22(24)35-2)12-19-25(33)30-27(37)31(26(19)34)18-9-4-3-5-10-18/h3-14H,15H2,1-2H3,(H,29,32)(H,30,33,37)/b19-12- |
| InChIKey | HLACVPLKSBMPMS-UNOMPAQXSA-N |
| XLogP | 4.61 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|