C26H19Br2N3O4S — CID 126268465
2-[2,4-dibromo-6-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126268465) has the molecular formula C26H19Br2N3O4S and a molecular weight of 629.33 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2,4-dibromo-6-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126268465 |
| Molecular Formula | C26H19Br2N3O4S |
| Molecular Weight | 629.33 g/mol |
| Exact Mass | 626.95 |
| IUPAC Name | 2-[2,4-dibromo-6-[(Z)-(4,6-dioxo-1-phenyl-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1c(Br)cc(Br)cc1/C=C1/C(=O)NC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H19Br2N3O4S/c1-15-7-5-6-10-21(15)29-22(32)14-35-23-16(11-17(27)13-20(23)28)12-19-24(33)30-26(36)31(25(19)34)18-8-3-2-4-9-18/h2-13H,14H2,1H3,(H,29,32)(H,30,33,36)/b19-12- |
| InChIKey | HKYLLYPUDNYAIZ-UNOMPAQXSA-N |
| XLogP | 5.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|