C28H21Br2N3O7 — CID 126279665
methyl 4-[(5Z)-5-[[3,5-dibromo-2-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126279665) has the molecular formula C28H21Br2N3O7 and a molecular weight of 671.30 g/mol. Its IUPAC name is methyl 4-[(5Z)-5-[[3,5-dibromo-2-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5Z)-5-[[3,5-dibromo-2-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126279665 |
| Molecular Formula | C28H21Br2N3O7 |
| Molecular Weight | 671.30 g/mol |
| Exact Mass | 668.97 |
| IUPAC Name | methyl 4-[(5Z)-5-[[3,5-dibromo-2-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C/c3cc(Br)cc(Br)c3OCC(=O)Nc3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C28H21Br2N3O7/c1-15-5-3-4-6-22(15)31-23(34)14-40-24-17(11-18(29)13-21(24)30)12-20-25(35)32-28(38)33(26(20)36)19-9-7-16(8-10-19)27(37)39-2/h3-13H,14H2,1-2H3,(H,31,34)(H,32,35,38)/b20-12- |
| InChIKey | YPNBRPLSSYDFEC-NDENLUEZSA-N |
| XLogP | 4.99 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|