C28H22BrN3O8 — CID 126385635
methyl 4-[(5Z)-5-[[3-bromo-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126385635) has the molecular formula C28H22BrN3O8 and a molecular weight of 608.40 g/mol. Its IUPAC name is methyl 4-[(5Z)-5-[[3-bromo-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5Z)-5-[[3-bromo-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126385635 |
| Molecular Formula | C28H22BrN3O8 |
| Molecular Weight | 608.40 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | methyl 4-[(5Z)-5-[[3-bromo-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C/c3ccc(OCC(=O)Nc4ccccc4OC)c(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H22BrN3O8/c1-38-23-6-4-3-5-21(23)30-24(33)15-40-22-12-7-16(14-20(22)29)13-19-25(34)31-28(37)32(26(19)35)18-10-8-17(9-11-18)27(36)39-2/h3-14H,15H2,1-2H3,(H,30,33)(H,31,34,37)/b19-13- |
| InChIKey | DHBPIHPGROQDBZ-UYRXBGFRSA-N |
| XLogP | 3.93 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|