C30H27N3O8 — CID 126271906
methyl 4-[(5Z)-5-[[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126271906) has the molecular formula C30H27N3O8 and a molecular weight of 557.56 g/mol. Its IUPAC name is methyl 4-[(5Z)-5-[[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5Z)-5-[[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126271906 |
| Molecular Formula | C30H27N3O8 |
| Molecular Weight | 557.56 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | methyl 4-[(5Z)-5-[[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C/c3ccc(OCC(=O)Nc4ccc(C)cc4C)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C30H27N3O8/c1-17-5-11-23(18(2)13-17)31-26(34)16-41-24-12-6-19(15-25(24)39-3)14-22-27(35)32-30(38)33(28(22)36)21-9-7-20(8-10-21)29(37)40-4/h5-15H,16H2,1-4H3,(H,31,34)(H,32,35,38)/b22-14- |
| InChIKey | OHJWTYDLPBKGFW-HMAPJEAMSA-N |
| XLogP | 3.78 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|