C26H18BrCl2N3O6 — CID 126386612
2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide (PubChem CID 126386612) has the molecular formula C26H18BrCl2N3O6 and a molecular weight of 619.26 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126386612 |
| Molecular Formula | C26H18BrCl2N3O6 |
| Molecular Weight | 619.26 g/mol |
| Exact Mass | 616.98 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[1-(3,4-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=C2/C(=O)NC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1Br |
| InChI | InChI=1S/C26H18BrCl2N3O6/c1-37-22-5-3-2-4-20(22)30-23(33)13-38-21-9-6-14(11-17(21)27)10-16-24(34)31-26(36)32(25(16)35)15-7-8-18(28)19(29)12-15/h2-12H,13H2,1H3,(H,30,33)(H,31,34,36)/b16-10- |
| InChIKey | XJAWPWWGDBOLOK-YBEGLDIGSA-N |
| XLogP | 5.45 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.26 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|