C25H17BrFN3O6 — CID 126393516
2-[2-bromo-4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126393516) has the molecular formula C25H17BrFN3O6 and a molecular weight of 554.33 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126393516 |
| Molecular Formula | C25H17BrFN3O6 |
| Molecular Weight | 554.33 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(/C=C2/C(=O)NC(=O)N(c3ccc(O)cc3)C2=O)cc1Br)Nc1ccccc1F |
| InChI | InChI=1S/C25H17BrFN3O6/c26-18-12-14(5-10-21(18)36-13-22(32)28-20-4-2-1-3-19(20)27)11-17-23(33)29-25(35)30(24(17)34)15-6-8-16(31)9-7-15/h1-12,31H,13H2,(H,28,32)(H,29,33,35)/b17-11- |
| InChIKey | YNQFJAYMAQYTLZ-BOPFTXTBSA-N |
| XLogP | 3.98 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|