C28H23Br2N3O6 — CID 126260892
2-[2,4-dibromo-6-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126260892) has the molecular formula C28H23Br2N3O6 and a molecular weight of 657.32 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2,4-dibromo-6-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126260892 |
| Molecular Formula | C28H23Br2N3O6 |
| Molecular Weight | 657.32 g/mol |
| Exact Mass | 655.00 |
| IUPAC Name | 2-[2,4-dibromo-6-[(E)-[1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Br)cc(Br)c3OCC(=O)Nc3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C28H23Br2N3O6/c1-3-38-21-9-7-20(8-10-21)33-27(36)22(26(35)32-28(33)37)13-17-12-18(29)14-23(30)25(17)39-15-24(34)31-19-6-4-5-16(2)11-19/h4-14H,3,15H2,1-2H3,(H,31,34)(H,32,35,37)/b22-13+ |
| InChIKey | FMPMEZHUMDMKQD-LPYMAVHISA-N |
| XLogP | 5.60 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.32 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|