C27H20Br2ClN3O5 — CID 126267706
N-(4-chlorophenyl)-2-[2,4-dibromo-6-[(Z)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126267706) has the molecular formula C27H20Br2ClN3O5 and a molecular weight of 661.73 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2,4-dibromo-6-[(Z)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[2,4-dibromo-6-[(Z)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126267706 |
| Molecular Formula | C27H20Br2ClN3O5 |
| Molecular Weight | 661.73 g/mol |
| Exact Mass | 658.95 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2,4-dibromo-6-[(Z)-[1-(3,4-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(N2C(=O)NC(=O)/C(=C/c3cc(Br)cc(Br)c3OCC(=O)Nc3ccc(Cl)cc3)C2=O)cc1C |
| InChI | InChI=1S/C27H20Br2ClN3O5/c1-14-3-8-20(9-15(14)2)33-26(36)21(25(35)32-27(33)37)11-16-10-17(28)12-22(29)24(16)38-13-23(34)31-19-6-4-18(30)5-7-19/h3-12H,13H2,1-2H3,(H,31,34)(H,32,35,37)/b21-11- |
| InChIKey | CUTGCWQHOIZENM-NHDPSOOVSA-N |
| XLogP | 6.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|