C31H29Br2N3O7 — CID 126273231
2-[2,4-dibromo-6-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126273231) has the molecular formula C31H29Br2N3O7 and a molecular weight of 715.39 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2,4-dibromo-6-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126273231 |
| Molecular Formula | C31H29Br2N3O7 |
| Molecular Weight | 715.39 g/mol |
| Exact Mass | 713.04 |
| IUPAC Name | 2-[2,4-dibromo-6-[(E)-[1-(3-ethoxy-4-propoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCCOc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Br)cc(Br)c3OCC(=O)Nc3ccccc3C)C2=O)cc1OCC |
| InChI | InChI=1S/C31H29Br2N3O7/c1-4-12-42-25-11-10-21(16-26(25)41-5-2)36-30(39)22(29(38)35-31(36)40)14-19-13-20(32)15-23(33)28(19)43-17-27(37)34-24-9-7-6-8-18(24)3/h6-11,13-16H,4-5,12,17H2,1-3H3,(H,34,37)(H,35,38,40)/b22-14+ |
| InChIKey | RZEGECMUGMQZQK-HYARGMPZSA-N |
| XLogP | 6.39 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.39 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|