C27H20Br2N4O7 — CID 126263670
2-[2,4-dibromo-6-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126263670) has the molecular formula C27H20Br2N4O7 and a molecular weight of 672.29 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[2,4-dibromo-6-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126263670 |
| Molecular Formula | C27H20Br2N4O7 |
| Molecular Weight | 672.29 g/mol |
| Exact Mass | 669.97 |
| IUPAC Name | 2-[2,4-dibromo-6-[(Z)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2c(Br)cc(Br)cc2/C=C2/C(=O)NC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)c1C |
| InChI | InChI=1S/C27H20Br2N4O7/c1-14-4-3-5-22(15(14)2)30-23(34)13-40-24-16(10-17(28)12-21(24)29)11-20-25(35)31-27(37)32(26(20)36)18-6-8-19(9-7-18)33(38)39/h3-12H,13H2,1-2H3,(H,30,34)(H,31,35,37)/b20-11- |
| InChIKey | RWJMKJHRICHRRK-JAIQZWGSSA-N |
| XLogP | 5.42 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|