C19H12Br2N4O7 — CID 126263594
2-[2,4-dibromo-6-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126263594) has the molecular formula C19H12Br2N4O7 and a molecular weight of 568.13 g/mol. Its IUPAC name is 2-[2,4-dibromo-6-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[2,4-dibromo-6-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126263594 |
| Molecular Formula | C19H12Br2N4O7 |
| Molecular Weight | 568.13 g/mol |
| Exact Mass | 565.91 |
| IUPAC Name | 2-[2,4-dibromo-6-[(Z)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1c(Br)cc(Br)cc1/C=C1/C(=O)NC(=O)N(c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C19H12Br2N4O7/c20-10-4-9(16(14(21)6-10)32-8-15(22)26)5-13-17(27)23-19(29)24(18(13)28)11-2-1-3-12(7-11)25(30)31/h1-7H,8H2,(H2,22,26)(H,23,27,29)/b13-5- |
| InChIKey | QUYLVMZLVLISIS-ACAGNQJTSA-N |
| XLogP | 2.65 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|