C24H15Br2N3O8S — CID 126050176
[2,4-dibromo-6-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126050176) has the molecular formula C24H15Br2N3O8S and a molecular weight of 665.27 g/mol. Its IUPAC name is [2,4-dibromo-6-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-dibromo-6-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126050176 |
| Molecular Formula | C24H15Br2N3O8S |
| Molecular Weight | 665.27 g/mol |
| Exact Mass | 662.89 |
| IUPAC Name | [2,4-dibromo-6-[(E)-[1-(3-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(Br)cc(Br)cc2/C=C2\C(=O)NC(=O)N(c3cccc([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C24H15Br2N3O8S/c1-13-5-7-18(8-6-13)38(35,36)37-21-14(9-15(25)11-20(21)26)10-19-22(30)27-24(32)28(23(19)31)16-3-2-4-17(12-16)29(33)34/h2-12H,1H3,(H,27,30,32)/b19-10+ |
| InChIKey | AHRRDIYSFKIYGZ-VXLYETTFSA-N |
| XLogP | 4.86 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.27 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|