C19H13Br2ClN2O4 — CID 126050847
(5E)-1-(3-chlorophenyl)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126050847) has the molecular formula C19H13Br2ClN2O4 and a molecular weight of 528.58 g/mol. Its IUPAC name is (5E)-1-(3-chlorophenyl)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chlorophenyl)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126050847 |
| Molecular Formula | C19H13Br2ClN2O4 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 525.89 |
| IUPAC Name | (5E)-1-(3-chlorophenyl)-5-[(3,5-dibromo-2-ethoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1c(Br)cc(Br)cc1/C=C1\C(=O)NC(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C19H13Br2ClN2O4/c1-2-28-16-10(6-11(20)8-15(16)21)7-14-17(25)23-19(27)24(18(14)26)13-5-3-4-12(22)9-13/h3-9H,2H2,1H3,(H,23,25,27)/b14-7+ |
| InChIKey | BZTNOUIZTAWPIV-VGOFMYFVSA-N |
| XLogP | 4.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|