C20H15Br2ClN2O4 — CID 126052228
(5E)-1-(4-chlorophenyl)-5-[(3,5-dibromo-2-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126052228) has the molecular formula C20H15Br2ClN2O4 and a molecular weight of 542.61 g/mol. Its IUPAC name is (5E)-1-(4-chlorophenyl)-5-[(3,5-dibromo-2-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(4-chlorophenyl)-5-[(3,5-dibromo-2-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126052228 |
| Molecular Formula | C20H15Br2ClN2O4 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 539.91 |
| IUPAC Name | (5E)-1-(4-chlorophenyl)-5-[(3,5-dibromo-2-propoxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1c(Br)cc(Br)cc1/C=C1\C(=O)NC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H15Br2ClN2O4/c1-2-7-29-17-11(8-12(21)10-16(17)22)9-15-18(26)24-20(28)25(19(15)27)14-5-3-13(23)4-6-14/h3-6,8-10H,2,7H2,1H3,(H,24,26,28)/b15-9+ |
| InChIKey | ICJANFCOULYMNC-OQLLNIDSSA-N |
| XLogP | 5.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|