C25H18Br2N2O5 — CID 126059189
(5E)-5-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126059189) has the molecular formula C25H18Br2N2O5 and a molecular weight of 586.24 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126059189 |
| Molecular Formula | C25H18Br2N2O5 |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 583.96 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(COc2c(Br)cc(Br)cc2/C=C2\C(=O)NC(=O)N(c3ccc(O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H18Br2N2O5/c1-14-2-4-15(5-3-14)13-34-22-16(10-17(26)12-21(22)27)11-20-23(31)28-25(33)29(24(20)32)18-6-8-19(30)9-7-18/h2-12,30H,13H2,1H3,(H,28,31,33)/b20-11+ |
| InChIKey | AKYVQMADJUBKLO-RGVLZGJSSA-N |
| XLogP | 5.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|