C25H18Br2N2O4 — CID 126055050
(5E)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126055050) has the molecular formula C25H18Br2N2O4 and a molecular weight of 570.24 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126055050 |
| Molecular Formula | C25H18Br2N2O4 |
| Molecular Weight | 570.24 g/mol |
| Exact Mass | 567.96 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(COc2c(Br)cc(/C=C3\C(=O)NC(=O)N(c4ccccc4)C3=O)cc2Br)cc1 |
| InChI | InChI=1S/C25H18Br2N2O4/c1-15-7-9-16(10-8-15)14-33-22-20(26)12-17(13-21(22)27)11-19-23(30)28-25(32)29(24(19)31)18-5-3-2-4-6-18/h2-13H,14H2,1H3,(H,28,30,32)/b19-11+ |
| InChIKey | TXYSJWHQLDOVBQ-YBFXNURJSA-N |
| XLogP | 5.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.24 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|