C31H21Br2FN2O5 — CID 126050508
(5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126050508) has the molecular formula C31H21Br2FN2O5 and a molecular weight of 680.32 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126050508 |
| Molecular Formula | C31H21Br2FN2O5 |
| Molecular Weight | 680.32 g/mol |
| Exact Mass | 677.98 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(3-fluorophenyl)methoxy]phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(OCc3ccccc3)cc2)C(=O)/C1=C/c1cc(Br)c(OCc2cccc(F)c2)c(Br)c1 |
| InChI | InChI=1S/C31H21Br2FN2O5/c32-26-15-21(16-27(33)28(26)41-18-20-7-4-8-22(34)13-20)14-25-29(37)35-31(39)36(30(25)38)23-9-11-24(12-10-23)40-17-19-5-2-1-3-6-19/h1-16H,17-18H2,(H,35,37,39)/b25-14+ |
| InChIKey | GOKIAIJGRZROMD-AFUMVMLFSA-N |
| XLogP | 7.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.32 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|