C35H24Br2N2O5 — CID 126055598
(5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126055598) has the molecular formula C35H24Br2N2O5 and a molecular weight of 712.39 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126055598 |
| Molecular Formula | C35H24Br2N2O5 |
| Molecular Weight | 712.39 g/mol |
| Exact Mass | 710.01 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(OCc3ccccc3)cc2)C(=O)/C1=C/c1cc(Br)c(OCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C35H24Br2N2O5/c36-30-18-23(19-31(37)32(30)44-21-25-11-6-10-24-9-4-5-12-28(24)25)17-29-33(40)38-35(42)39(34(29)41)26-13-15-27(16-14-26)43-20-22-7-2-1-3-8-22/h1-19H,20-21H2,(H,38,40,42)/b29-17+ |
| InChIKey | VLHDROCBWVMASA-STBIYBPSSA-N |
| XLogP | 8.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.39 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|