C26H19Br2N3O6 — CID 126051014
(5E)-5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126051014) has the molecular formula C26H19Br2N3O6 and a molecular weight of 629.26 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126051014 |
| Molecular Formula | C26H19Br2N3O6 |
| Molecular Weight | 629.26 g/mol |
| Exact Mass | 626.96 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1-(3,4-dimethylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Br)cc(Br)c3OCc3ccc([N+](=O)[O-])cc3)C2=O)cc1C |
| InChI | InChI=1S/C26H19Br2N3O6/c1-14-3-6-20(9-15(14)2)30-25(33)21(24(32)29-26(30)34)11-17-10-18(27)12-22(28)23(17)37-13-16-4-7-19(8-5-16)31(35)36/h3-12H,13H2,1-2H3,(H,29,32,34)/b21-11+ |
| InChIKey | WCKOAVOQLDQYFN-SRZZPIQSSA-N |
| XLogP | 5.98 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.26 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|