C30H19Br2N3O6 — CID 126053564
5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126053564) has the molecular formula C30H19Br2N3O6 and a molecular weight of 677.31 g/mol. Its IUPAC name is 5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126053564 |
| Molecular Formula | C30H19Br2N3O6 |
| Molecular Weight | 677.31 g/mol |
| Exact Mass | 674.96 |
| IUPAC Name | 5-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1C(=Cc2cc(Br)cc(Br)c2OCc2ccc([N+](=O)[O-])cc2)C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C30H19Br2N3O6/c31-21-15-20(27(26(32)17-21)41-18-19-11-13-24(14-12-19)35(39)40)16-25-28(36)33(22-7-3-1-4-8-22)30(38)34(29(25)37)23-9-5-2-6-10-23/h1-17H,18H2 |
| InChIKey | MYTAMJCSWHFOQO-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.31 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|