C30H19Br2ClN2O4 — CID 126050240
5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126050240) has the molecular formula C30H19Br2ClN2O4 and a molecular weight of 666.75 g/mol. Its IUPAC name is 5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126050240 |
| Molecular Formula | C30H19Br2ClN2O4 |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 663.94 |
| IUPAC Name | 5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1C(=Cc2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C30H19Br2ClN2O4/c31-24-16-19(17-25(32)27(24)39-18-20-9-7-8-14-26(20)33)15-23-28(36)34(21-10-3-1-4-11-21)30(38)35(29(23)37)22-12-5-2-6-13-22/h1-17H,18H2 |
| InChIKey | ARUWSYKPNYJLIT-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|