C22H14Br2ClNO2 — CID 126118242
(3Z)-3-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one (PubChem CID 126118242) has the molecular formula C22H14Br2ClNO2 and a molecular weight of 519.62 g/mol. Its IUPAC name is (3Z)-3-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 126118242 |
| Molecular Formula | C22H14Br2ClNO2 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 516.91 |
| IUPAC Name | (3Z)-3-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C/c1cc(Br)c(OCc2ccccc2Cl)c(Br)c1 |
| InChI | InChI=1S/C22H14Br2ClNO2/c23-17-10-13(9-16-15-6-2-4-8-20(15)26-22(16)27)11-18(24)21(17)28-12-14-5-1-3-7-19(14)25/h1-11H,12H2,(H,26,27)/b16-9- |
| InChIKey | AEKRADWREUJOSG-SXGWCWSVSA-N |
| XLogP | 6.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|