C27H16Br2O3 — CID 126396053
2-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]indene-1,3-dione (PubChem CID 126396053) has the molecular formula C27H16Br2O3 and a molecular weight of 548.23 g/mol. Its IUPAC name is 2-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 126396053 |
| Molecular Formula | C27H16Br2O3 |
| Molecular Weight | 548.23 g/mol |
| Exact Mass | 545.95 |
| IUPAC Name | 2-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cc(Br)c(OCc3cccc4ccccc34)c(Br)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C27H16Br2O3/c28-23-13-16(12-22-25(30)20-10-3-4-11-21(20)26(22)31)14-24(29)27(23)32-15-18-8-5-7-17-6-1-2-9-19(17)18/h1-14H,15H2 |
| InChIKey | JKOPEJAEUDDEAB-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.23 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|