C27H17Br2ClN2O3 — CID 126108554
(5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126108554) has the molecular formula C27H17Br2ClN2O3 and a molecular weight of 612.71 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126108554 |
| Molecular Formula | C27H17Br2ClN2O3 |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 609.93 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Br)c(OCc3cccc4ccccc34)c(Br)c2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H17Br2ClN2O3/c28-22-11-16(13-24-26(33)32(27(34)31-24)20-9-4-8-19(30)14-20)12-23(29)25(22)35-15-18-7-3-6-17-5-1-2-10-21(17)18/h1-14H,15H2,(H,31,34)/b24-13+ |
| InChIKey | DDSRODXNHRXUQT-ZMOGYAJESA-N |
| XLogP | 7.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|