C23H13Br2Cl3N2O3 — CID 126237589
(5E)-3-(4-chlorophenyl)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126237589) has the molecular formula C23H13Br2Cl3N2O3 and a molecular weight of 631.54 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126237589 |
| Molecular Formula | C23H13Br2Cl3N2O3 |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 627.84 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(Br)c2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H13Br2Cl3N2O3/c24-17-7-12(8-18(25)21(17)33-11-13-1-2-15(27)10-19(13)28)9-20-22(31)30(23(32)29-20)16-5-3-14(26)4-6-16/h1-10H,11H2,(H,29,32)/b20-9+ |
| InChIKey | CWPYEEUJZDLYDE-AWQFTUOYSA-N |
| XLogP | 7.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|