C23H14Cl3FN2O3 — CID 126179138
(5E)-3-(4-chlorophenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126179138) has the molecular formula C23H14Cl3FN2O3 and a molecular weight of 491.73 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126179138 |
| Molecular Formula | C23H14Cl3FN2O3 |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[[3,5-dichloro-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Cl)c(OCc3ccccc3F)c(Cl)c2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H14Cl3FN2O3/c24-15-5-7-16(8-6-15)29-22(30)20(28-23(29)31)11-13-9-17(25)21(18(26)10-13)32-12-14-3-1-2-4-19(14)27/h1-11H,12H2,(H,28,31)/b20-11+ |
| InChIKey | MBSICQVKASMUST-RGVLZGJSSA-N |
| XLogP | 6.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|