C18H11Br2ClN2O5 — CID 126259679
2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126259679) has the molecular formula C18H11Br2ClN2O5 and a molecular weight of 530.56 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126259679 |
| Molecular Formula | C18H11Br2ClN2O5 |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 527.87 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc1Br |
| InChI | InChI=1S/C18H11Br2ClN2O5/c19-12-5-9(6-13(20)16(12)28-8-15(24)25)7-14-17(26)23(18(27)22-14)11-3-1-10(21)2-4-11/h1-7H,8H2,(H,22,27)(H,24,25)/b14-7+ |
| InChIKey | VGHLZIWZHVNPIK-VGOFMYFVSA-N |
| XLogP | 4.43 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|