C24H17BrClN3O4 — CID 126173692
2-[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]-N-phenylacetamide (PubChem CID 126173692) has the molecular formula C24H17BrClN3O4 and a molecular weight of 526.77 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126173692 |
| Molecular Formula | C24H17BrClN3O4 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc1Br)Nc1ccccc1 |
| InChI | InChI=1S/C24H17BrClN3O4/c25-19-12-15(6-11-21(19)33-14-22(30)27-17-4-2-1-3-5-17)13-20-23(31)29(24(32)28-20)18-9-7-16(26)8-10-18/h1-13H,14H2,(H,27,30)(H,28,32)/b20-13+ |
| InChIKey | JUGWJMRYPGQJQF-DEDYPNTBSA-N |
| XLogP | 5.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|