C26H21BrClN3O5 — CID 126235383
2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126235383) has the molecular formula C26H21BrClN3O5 and a molecular weight of 570.83 g/mol. Its IUPAC name is 2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126235383 |
| Molecular Formula | C26H21BrClN3O5 |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | 2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)c(Br)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H21BrClN3O5/c1-15-3-7-18(8-4-15)29-24(32)14-36-23-13-20(27)16(12-22(23)35-2)11-21-25(33)31(26(34)30-21)19-9-5-17(28)6-10-19/h3-13H,14H2,1-2H3,(H,29,32)(H,30,34)/b21-11+ |
| InChIKey | KYQWLXNBTAXXDD-SRZZPIQSSA-N |
| XLogP | 5.53 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|