C20H16BrClN2O6 — CID 126181228
methyl 2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 126181228) has the molecular formula C20H16BrClN2O6 and a molecular weight of 495.71 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126181228 |
| Molecular Formula | C20H16BrClN2O6 |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | methyl 2-[5-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1cc(Br)c(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H16BrClN2O6/c1-28-16-8-11(14(21)9-17(16)30-10-18(25)29-2)7-15-19(26)24(20(27)23-15)13-5-3-12(22)4-6-13/h3-9H,10H2,1-2H3,(H,23,27)/b15-7+ |
| InChIKey | WNCJEJBCNJZVEF-VIZOYTHASA-N |
| XLogP | 3.76 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|