C20H15BrClN2O6- — CID 2190358
2-[5-bromo-4-[(Z)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxyphenoxy]acetate (PubChem CID 2190358) has the molecular formula C20H15BrClN2O6- and a molecular weight of 494.71 g/mol. Its IUPAC name is 2-[5-bromo-4-[(Z)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | 2-[5-bromo-4-[(Z)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 2190358 |
| Molecular Formula | C20H15BrClN2O6- |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 2-[5-bromo-4-[(Z)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOc1cc(/C=C2\NC(=O)N(c3cccc(Cl)c3)C2=O)c(Br)cc1OCC(=O)[O-] |
| InChI | InChI=1S/C20H16BrClN2O6/c1-2-29-16-7-11(14(21)9-17(16)30-10-18(25)26)6-15-19(27)24(20(28)23-15)13-5-3-4-12(22)8-13/h3-9H,2,10H2,1H3,(H,23,28)(H,25,26)/p-1/b15-6- |
| InChIKey | LTBIZMUMPDDTPC-UUASQNMZSA-M |
| XLogP | 2.73 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|