C25H19BrCl2N2O4 — CID 126020754
(5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 126020754) has the molecular formula C25H19BrCl2N2O4 and a molecular weight of 562.25 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126020754 |
| Molecular Formula | C25H19BrCl2N2O4 |
| Molecular Weight | 562.25 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | (5E)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(c3ccccc3)C2=O)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H19BrCl2N2O4/c1-2-33-22-11-16(10-21-24(31)30(25(32)29-21)18-6-4-3-5-7-18)19(26)13-23(22)34-14-15-8-9-17(27)12-20(15)28/h3-13H,2,14H2,1H3,(H,29,32)/b21-10+ |
| InChIKey | PDVSQTFWWFKVJD-UFFVCSGVSA-N |
| XLogP | 6.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.25 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|