C20H17BrCl2N2O3S — CID 126014632
(5Z)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126014632) has the molecular formula C20H17BrCl2N2O3S and a molecular weight of 516.24 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126014632 |
| Molecular Formula | C20H17BrCl2N2O3S |
| Molecular Weight | 516.24 g/mol |
| Exact Mass | 513.95 |
| IUPAC Name | (5Z)-5-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cc(OC)c(OCc3ccc(Cl)cc3Cl)cc2Br)NC1=S |
| InChI | InChI=1S/C20H17BrCl2N2O3S/c1-3-25-19(26)16(24-20(25)29)6-12-7-17(27-2)18(9-14(12)21)28-10-11-4-5-13(22)8-15(11)23/h4-9H,3,10H2,1-2H3,(H,24,29)/b16-6- |
| InChIKey | VADSDGXDICQWPN-SOFYXZRVSA-N |
| XLogP | 5.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|