C20H16Br2Cl2N2O2S — CID 126085979
(5Z)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126085979) has the molecular formula C20H16Br2Cl2N2O2S and a molecular weight of 579.14 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126085979 |
| Molecular Formula | C20H16Br2Cl2N2O2S |
| Molecular Weight | 579.14 g/mol |
| Exact Mass | 575.87 |
| IUPAC Name | (5Z)-5-[[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(Br)c2)NC1=S |
| InChI | InChI=1S/C20H16Br2Cl2N2O2S/c1-2-5-26-19(27)17(25-20(26)29)8-11-6-14(21)18(15(22)7-11)28-10-12-3-4-13(23)9-16(12)24/h3-4,6-9H,2,5,10H2,1H3,(H,25,29)/b17-8- |
| InChIKey | LHKORJQCGIWMKI-IUXPMGMMSA-N |
| XLogP | 6.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.14 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|