C19H15Br2FN2O2S — CID 90643012
(5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 90643012) has the molecular formula C19H15Br2FN2O2S and a molecular weight of 514.21 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 90643012 |
| Molecular Formula | C19H15Br2FN2O2S |
| Molecular Weight | 514.21 g/mol |
| Exact Mass | 511.92 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)c(OCc3ccc(F)cc3)c(Br)c2)NC1=S |
| InChI | InChI=1S/C19H15Br2FN2O2S/c1-2-24-18(25)16(23-19(24)27)9-12-7-14(20)17(15(21)8-12)26-10-11-3-5-13(22)6-4-11/h3-9H,2,10H2,1H3,(H,23,27)/b16-9+ |
| InChIKey | XZUICKIMWRGOFG-CXUHLZMHSA-N |
| XLogP | 5.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.21 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|