C20H18Br2N2O2S — CID 126014997
(5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126014997) has the molecular formula C20H18Br2N2O2S and a molecular weight of 510.25 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126014997 |
| Molecular Formula | C20H18Br2N2O2S |
| Molecular Weight | 510.25 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | (5Z)-5-[[3,5-dibromo-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-3-ethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cc(Br)c(OCc3ccc(C)cc3)c(Br)c2)NC1=S |
| InChI | InChI=1S/C20H18Br2N2O2S/c1-3-24-19(25)17(23-20(24)27)10-14-8-15(21)18(16(22)9-14)26-11-13-6-4-12(2)5-7-13/h4-10H,3,11H2,1-2H3,(H,23,27)/b17-10- |
| InChIKey | XZUCBLIQMIYNQL-YVLHZVERSA-N |
| XLogP | 5.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_I(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|